| Name | 2-Fluorobenzaldehyde |
| Synonyms | AKOS BBS-00003150 2-Fluorobenzaldeyde Fluorobenzaldehyde1 2-fluoro-benzaldehyd 2-FLUOROBENZALDEHYDE 2-Fluorobenzaldehyde LABOTEST-BB LT00941219 Benzaldehyde, o-fluoro- Ortho-Fluorobenzaldehyde ortho-Fluorobenzaldehyde 2-bromo-1-fluoro-3-methoxybenzene Fluorobenzaldehydemincolorlessliq |
| CAS | 446-52-6 |
| EINECS | 207-171-2 |
| InChI | InChI=1/C7H6BrFO/c1-10-6-4-2-3-5(9)7(6)8/h2-4H,1H3 |
| InChIKey | ZWDVQMVZZYIAHO-UHFFFAOYSA-N |
| Molecular Formula | C7H5FO |
| Molar Mass | 124.11 |
| Density | 1.178g/mLat 25°C(lit.) |
| Melting Point | −44.5°C(lit.) |
| Boling Point | 90-91°C46mm Hg(lit.) |
| Flash Point | 131°F |
| Water Solubility | INSOLUBLE |
| Vapor Presure | 0.796mmHg at 25°C |
| Appearance | Liquid |
| Specific Gravity | 1.178 |
| Color | Clear colorless to light brown |
| BRN | 507155 |
| Storage Condition | Inert atmosphere,2-8°C |
| Sensitive | Air Sensitive |
| Refractive Index | n20/D 1.521(lit.) |
| Physical and Chemical Properties | Density 1.178 melting point -44.5°C boiling point 172-174°C refractive index 1.5205-1.5225 flash point 55°C water-soluble INSOLUBLE |
| Use | Used as pesticide, pharmaceutical intermediates |
| Risk Codes | R10 - Flammable R36/37/38 - Irritating to eyes, respiratory system and skin. R22 - Harmful if swallowed |
| Safety Description | S16 - Keep away from sources of ignition. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S37/39 - Wear suitable gloves and eye/face protection |
| UN IDs | UN 1989 3/PG 3 |
| WGK Germany | 3 |
| RTECS | CU6140000 |
| FLUKA BRAND F CODES | 10-23 |
| HS Code | 29130000 |
| Hazard Note | Flammable |
| Hazard Class | 3 |
| Packing Group | III |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| introduction | 2-fluorobenzaldehyde is an important organic synthesis intermediate, which is widely used in medicine, dyes, pesticides, etc. In medicine, it can be used for the synthesis of a variety of drugs such as antihypertensive drugs, antipyretic, analgesic and anti-inflammatory drugs, anticancer drugs, muscle relaxation drugs, etc. In dye synthesis, the new dye synthesized from it has excellent properties such as bright luster, sun resistance, water resistance and organic solvents. In pesticide production, the pesticide synthesized from it has the characteristics of high biological activity, long-lasting efficacy and small side effects compared with traditional pesticides. |
| Use | Used as pesticide and pharmaceutical intermediate |